C8H16N2O2S — CID 115739196
2-(azetidin-3-yl)-N-(2-methylsulfinylethyl)acetamide (PubChem CID 115739196) has the molecular formula C8H16N2O2S and a molecular weight of 204.29 g/mol. Its IUPAC name is 2-(azetidin-3-yl)-N-(2-methylsulfinylethyl)acetamide.
| Compound Name | 2-(azetidin-3-yl)-N-(2-methylsulfinylethyl)acetamide |
|---|---|
| PubChem CID | 115739196 |
| Molecular Formula | C8H16N2O2S |
| Molecular Weight | 204.29 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | 2-(azetidin-3-yl)-N-(2-methylsulfinylethyl)acetamide |
| SMILES | CS(=O)CCNC(=O)CC1CNC1 |
| InChI | InChI=1S/C8H16N2O2S/c1-13(12)3-2-10-8(11)4-7-5-9-6-7/h7,9H,2-6H2,1H3,(H,10,11) |
| InChIKey | BBGGUXNNENLPHA-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.29 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |