C14H9ClF3N5O — CID 11573966
5-chloro-15-(2,2,2-trifluoroethoxy)-2,4,8,9,11-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,9,11,14,16-heptaene (PubChem CID 11573966) has the molecular formula C14H9ClF3N5O and a molecular weight of 355.71 g/mol. Its IUPAC name is 5-chloro-15-(2,2,2-trifluoroethoxy)-2,4,8,9,11-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,9,11,14,16-heptaene.
| Compound Name | 5-chloro-15-(2,2,2-trifluoroethoxy)-2,4,8,9,11-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,9,11,14,16-heptaene |
|---|---|
| PubChem CID | 11573966 |
| Molecular Formula | C14H9ClF3N5O |
| Molecular Weight | 355.71 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | 5-chloro-15-(2,2,2-trifluoroethoxy)-2,4,8,9,11-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,9,11,14,16-heptaene |
| SMILES | FC(F)(F)COc1ccc2c(c1)-c1ncnn1Cc1c(Cl)ncn1-2 |
| InChI | InChI=1S/C14H9ClF3N5O/c15-12-11-4-23-13(19-6-21-23)9-3-8(24-5-14(16,17)18)1-2-10(9)22(11)7-20-12/h1-3,6-7H,4-5H2 |
| InChIKey | KXWGWYFFBMVQDP-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 57.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.71 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |