C10H15N3OS — CID 115740323
2-(aminomethyl)-N-pent-4-en-2-yl-1,3-thiazole-4-carboxamide (PubChem CID 115740323) has the molecular formula C10H15N3OS and a molecular weight of 225.32 g/mol. Its IUPAC name is 2-(aminomethyl)-N-pent-4-en-2-yl-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(aminomethyl)-N-pent-4-en-2-yl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 115740323 |
| Molecular Formula | C10H15N3OS |
| Molecular Weight | 225.32 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | 2-(aminomethyl)-N-pent-4-en-2-yl-1,3-thiazole-4-carboxamide |
| SMILES | C=CCC(C)NC(=O)c1csc(CN)n1 |
| InChI | InChI=1S/C10H15N3OS/c1-3-4-7(2)12-10(14)8-6-15-9(5-11)13-8/h3,6-7H,1,4-5,11H2,2H3,(H,12,14) |
| InChIKey | APQNLVDQSNJTLB-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.32 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|