About 3-[[5-(2,3-dichloro-4-fluorophenyl)tetrazol-1-yl]methyl]pyridine
3-[[5-(2,3-dichloro-4-fluorophenyl)tetrazol-1-yl]methyl]pyridine (PubChem CID 11574070) has the molecular formula C13H8Cl2FN5
and a molecular weight of 324.15 g/mol. Its IUPAC name is 3-[[5-(2,3-dichloro-4-fluorophenyl)tetrazol-1-yl]methyl]pyridine.
Molecular Properties
| Compound Name | 3-[[5-(2,3-dichloro-4-fluorophenyl)tetrazol-1-yl]methyl]pyridine |
| PubChem CID | 11574070 |
| Molecular Formula | C13H8Cl2FN5 |
| Molecular Weight | 324.15 g/mol |
| Exact Mass | 323.01 |
| IUPAC Name | 3-[[5-(2,3-dichloro-4-fluorophenyl)tetrazol-1-yl]methyl]pyridine |
| SMILES | Fc1ccc(-c2nnnn2Cc2cccnc2)c(Cl)c1Cl |
| InChI | InChI=1S/C13H8Cl2FN5/c14-11-9(3-4-10(16)12(11)15)13-18-19-20-21(13)7-8-2-1-5-17-6-8/h1-6H,7H2 |
| InChIKey | PDNKNHYHFRICPY-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.15 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 3-[[5-(2,3-dichloro-4-fluorophenyl)tetrazol-1-yl]methyl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[5-(2,3-dichloro-4-fluorophenyl)tetrazol-1-yl]methyl]pyridine?
The IUPAC name of 3-[[5-(2,3-dichloro-4-fluorophenyl)tetrazol-1-yl]methyl]pyridine (CID 11574070) is 3-[[5-(2,3-dichloro-4-fluorophenyl)tetrazol-1-yl]methyl]pyridine.
What is the SMILES notation for 3-[[5-(2,3-dichloro-4-fluorophenyl)tetrazol-1-yl]methyl]pyridine?
The canonical SMILES for 3-[[5-(2,3-dichloro-4-fluorophenyl)tetrazol-1-yl]methyl]pyridine is Fc1ccc(-c2nnnn2Cc2cccnc2)c(Cl)c1Cl.
What is the InChIKey of 3-[[5-(2,3-dichloro-4-fluorophenyl)tetrazol-1-yl]methyl]pyridine?
The InChIKey is PDNKNHYHFRICPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8Cl2FN5/c14-11-9(3-4-10(16)12(11)15)13-18-19-20-21(13)7-8-2-1-5-17-6-8/h1-6H,7H2.
What are the key properties of 3-[[5-(2,3-dichloro-4-fluorophenyl)tetrazol-1-yl]methyl]pyridine?
3-[[5-(2,3-dichloro-4-fluorophenyl)tetrazol-1-yl]methyl]pyridine has a molecular weight of 324.15 g/mol, XLogP of 3.23, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[5-(2,3-dichloro-4-fluorophenyl)tetrazol-1-yl]methyl]pyridine is sourced from PubChem (CID 11574070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).