About 2-hydroxyethyl 6-[(2,4-difluorophenyl)sulfamoyl]cyclohexene-1-carboxylate
2-hydroxyethyl 6-[(2,4-difluorophenyl)sulfamoyl]cyclohexene-1-carboxylate (PubChem CID 11574077) has the molecular formula C15H17F2NO5S
and a molecular weight of 361.37 g/mol. Its IUPAC name is 2-hydroxyethyl 6-[(2,4-difluorophenyl)sulfamoyl]cyclohexene-1-carboxylate.
Molecular Properties
| Compound Name | 2-hydroxyethyl 6-[(2,4-difluorophenyl)sulfamoyl]cyclohexene-1-carboxylate |
| PubChem CID | 11574077 |
| Molecular Formula | C15H17F2NO5S |
| Molecular Weight | 361.37 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | 2-hydroxyethyl 6-[(2,4-difluorophenyl)sulfamoyl]cyclohexene-1-carboxylate |
| SMILES | O=C(OCCO)C1=CCCCC1S(=O)(=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C15H17F2NO5S/c16-10-5-6-13(12(17)9-10)18-24(21,22)14-4-2-1-3-11(14)15(20)23-8-7-19/h3,5-6,9,14,18-19H,1-2,4,7-8H2 |
| InChIKey | NFWNASPTWXNOTD-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.37 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-hydroxyethyl 6-[(2,4-difluorophenyl)sulfamoyl]cyclohexene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxyethyl 6-[(2,4-difluorophenyl)sulfamoyl]cyclohexene-1-carboxylate?
The IUPAC name of 2-hydroxyethyl 6-[(2,4-difluorophenyl)sulfamoyl]cyclohexene-1-carboxylate (CID 11574077) is 2-hydroxyethyl 6-[(2,4-difluorophenyl)sulfamoyl]cyclohexene-1-carboxylate.
What is the SMILES notation for 2-hydroxyethyl 6-[(2,4-difluorophenyl)sulfamoyl]cyclohexene-1-carboxylate?
The canonical SMILES for 2-hydroxyethyl 6-[(2,4-difluorophenyl)sulfamoyl]cyclohexene-1-carboxylate is O=C(OCCO)C1=CCCCC1S(=O)(=O)Nc1ccc(F)cc1F.
What is the InChIKey of 2-hydroxyethyl 6-[(2,4-difluorophenyl)sulfamoyl]cyclohexene-1-carboxylate?
The InChIKey is NFWNASPTWXNOTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17F2NO5S/c16-10-5-6-13(12(17)9-10)18-24(21,22)14-4-2-1-3-11(14)15(20)23-8-7-19/h3,5-6,9,14,18-19H,1-2,4,7-8H2.
What are the key properties of 2-hydroxyethyl 6-[(2,4-difluorophenyl)sulfamoyl]cyclohexene-1-carboxylate?
2-hydroxyethyl 6-[(2,4-difluorophenyl)sulfamoyl]cyclohexene-1-carboxylate has a molecular weight of 361.37 g/mol, XLogP of 1.72, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyethyl 6-[(2,4-difluorophenyl)sulfamoyl]cyclohexene-1-carboxylate is sourced from PubChem (CID 11574077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).