C11H15BrN2O2 — CID 115741272
4-[(5-bromo-3-pyridinyl)methyl-methylamino]butanoic acid (PubChem CID 115741272) has the molecular formula C11H15BrN2O2 and a molecular weight of 287.16 g/mol. Its IUPAC name is 4-[(5-bromo-3-pyridinyl)methyl-methylamino]butanoic acid.
| Compound Name | 4-[(5-bromo-3-pyridinyl)methyl-methylamino]butanoic acid |
|---|---|
| PubChem CID | 115741272 |
| Molecular Formula | C11H15BrN2O2 |
| Molecular Weight | 287.16 g/mol |
| Exact Mass | 286.03 |
| IUPAC Name | 4-[(5-bromo-3-pyridinyl)methyl-methylamino]butanoic acid |
| SMILES | CN(CCCC(=O)O)Cc1cncc(Br)c1 |
| InChI | InChI=1S/C11H15BrN2O2/c1-14(4-2-3-11(15)16)8-9-5-10(12)7-13-6-9/h5-7H,2-4,8H2,1H3,(H,15,16) |
| InChIKey | DZYPLZVIRHDGLM-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.16 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |