C11H24N2S — CID 115741540
4-N-(2-ethylsulfanylethyl)-4-N-methylcyclohexane-1,4-diamine (PubChem CID 115741540) has the molecular formula C11H24N2S and a molecular weight of 216.39 g/mol. Its IUPAC name is 4-N-(2-ethylsulfanylethyl)-4-N-methylcyclohexane-1,4-diamine.
| Compound Name | 4-N-(2-ethylsulfanylethyl)-4-N-methylcyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 115741540 |
| Molecular Formula | C11H24N2S |
| Molecular Weight | 216.39 g/mol |
| Exact Mass | 216.17 |
| IUPAC Name | 4-N-(2-ethylsulfanylethyl)-4-N-methylcyclohexane-1,4-diamine |
| SMILES | CCSCCN(C)C1CCC(N)CC1 |
| InChI | InChI=1S/C11H24N2S/c1-3-14-9-8-13(2)11-6-4-10(12)5-7-11/h10-11H,3-9,12H2,1-2H3 |
| InChIKey | AELYHBNPLFGPTC-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.39 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|