C22H26N2O3 — CID 11574170
1-[2-[3-(2,2,3,3-tetramethylcyclopropanecarbonyl)indol-1-yl]ethyl]pyrrolidine-2,5-dione (PubChem CID 11574170) has the molecular formula C22H26N2O3 and a molecular weight of 366.46 g/mol. Its IUPAC name is 1-[2-[3-(2,2,3,3-tetramethylcyclopropanecarbonyl)indol-1-yl]ethyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[2-[3-(2,2,3,3-tetramethylcyclopropanecarbonyl)indol-1-yl]ethyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 11574170 |
| Molecular Formula | C22H26N2O3 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | 1-[2-[3-(2,2,3,3-tetramethylcyclopropanecarbonyl)indol-1-yl]ethyl]pyrrolidine-2,5-dione |
| SMILES | CC1(C)C(C(=O)c2cn(CCN3C(=O)CCC3=O)c3ccccc23)C1(C)C |
| InChI | InChI=1S/C22H26N2O3/c1-21(2)20(22(21,3)4)19(27)15-13-23(16-8-6-5-7-14(15)16)11-12-24-17(25)9-10-18(24)26/h5-8,13,20H,9-12H2,1-4H3 |
| InChIKey | AVPCNOHVEKLSOS-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 59.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|