About N-(3,6-dihydro-2H-pyran-5-ylmethyl)-2,4-dimethylaniline
N-(3,6-dihydro-2H-pyran-5-ylmethyl)-2,4-dimethylaniline (PubChem CID 115741866) has the molecular formula C14H19NO
and a molecular weight of 217.31 g/mol. Its IUPAC name is N-(3,6-dihydro-2H-pyran-5-ylmethyl)-2,4-dimethylaniline.
Molecular Properties
| Compound Name | N-(3,6-dihydro-2H-pyran-5-ylmethyl)-2,4-dimethylaniline |
| PubChem CID | 115741866 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | N-(3,6-dihydro-2H-pyran-5-ylmethyl)-2,4-dimethylaniline |
| SMILES | Cc1ccc(NCC2=CCCOC2)c(C)c1 |
| InChI | InChI=1S/C14H19NO/c1-11-5-6-14(12(2)8-11)15-9-13-4-3-7-16-10-13/h4-6,8,15H,3,7,9-10H2,1-2H3 |
| InChIKey | KMZVNIHKQTZFDK-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-(3,6-dihydro-2H-pyran-5-ylmethyl)-2,4-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,6-dihydro-2H-pyran-5-ylmethyl)-2,4-dimethylaniline?
The IUPAC name of N-(3,6-dihydro-2H-pyran-5-ylmethyl)-2,4-dimethylaniline (CID 115741866) is N-(3,6-dihydro-2H-pyran-5-ylmethyl)-2,4-dimethylaniline.
What is the SMILES notation for N-(3,6-dihydro-2H-pyran-5-ylmethyl)-2,4-dimethylaniline?
The canonical SMILES for N-(3,6-dihydro-2H-pyran-5-ylmethyl)-2,4-dimethylaniline is Cc1ccc(NCC2=CCCOC2)c(C)c1.
What is the InChIKey of N-(3,6-dihydro-2H-pyran-5-ylmethyl)-2,4-dimethylaniline?
The InChIKey is KMZVNIHKQTZFDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO/c1-11-5-6-14(12(2)8-11)15-9-13-4-3-7-16-10-13/h4-6,8,15H,3,7,9-10H2,1-2H3.
What are the key properties of N-(3,6-dihydro-2H-pyran-5-ylmethyl)-2,4-dimethylaniline?
N-(3,6-dihydro-2H-pyran-5-ylmethyl)-2,4-dimethylaniline has a molecular weight of 217.31 g/mol, XLogP of 3.06, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,6-dihydro-2H-pyran-5-ylmethyl)-2,4-dimethylaniline is sourced from PubChem (CID 115741866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).