About N-(3,6-dihydro-2H-pyran-5-ylmethyl)-2,3-dimethylbutan-1-amine
N-(3,6-dihydro-2H-pyran-5-ylmethyl)-2,3-dimethylbutan-1-amine (PubChem CID 115742149) has the molecular formula C12H23NO
and a molecular weight of 197.32 g/mol. Its IUPAC name is N-(3,6-dihydro-2H-pyran-5-ylmethyl)-2,3-dimethylbutan-1-amine.
Molecular Properties
| Compound Name | N-(3,6-dihydro-2H-pyran-5-ylmethyl)-2,3-dimethylbutan-1-amine |
| PubChem CID | 115742149 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | N-(3,6-dihydro-2H-pyran-5-ylmethyl)-2,3-dimethylbutan-1-amine |
| SMILES | CC(C)C(C)CNCC1=CCCOC1 |
| InChI | InChI=1S/C12H23NO/c1-10(2)11(3)7-13-8-12-5-4-6-14-9-12/h5,10-11,13H,4,6-9H2,1-3H3 |
| InChIKey | BQOSPSFEMPNEKP-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-(3,6-dihydro-2H-pyran-5-ylmethyl)-2,3-dimethylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,6-dihydro-2H-pyran-5-ylmethyl)-2,3-dimethylbutan-1-amine?
The IUPAC name of N-(3,6-dihydro-2H-pyran-5-ylmethyl)-2,3-dimethylbutan-1-amine (CID 115742149) is N-(3,6-dihydro-2H-pyran-5-ylmethyl)-2,3-dimethylbutan-1-amine.
What is the SMILES notation for N-(3,6-dihydro-2H-pyran-5-ylmethyl)-2,3-dimethylbutan-1-amine?
The canonical SMILES for N-(3,6-dihydro-2H-pyran-5-ylmethyl)-2,3-dimethylbutan-1-amine is CC(C)C(C)CNCC1=CCCOC1.
What is the InChIKey of N-(3,6-dihydro-2H-pyran-5-ylmethyl)-2,3-dimethylbutan-1-amine?
The InChIKey is BQOSPSFEMPNEKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO/c1-10(2)11(3)7-13-8-12-5-4-6-14-9-12/h5,10-11,13H,4,6-9H2,1-3H3.
What are the key properties of N-(3,6-dihydro-2H-pyran-5-ylmethyl)-2,3-dimethylbutan-1-amine?
N-(3,6-dihydro-2H-pyran-5-ylmethyl)-2,3-dimethylbutan-1-amine has a molecular weight of 197.32 g/mol, XLogP of 2.21, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,6-dihydro-2H-pyran-5-ylmethyl)-2,3-dimethylbutan-1-amine is sourced from PubChem (CID 115742149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).