C13H23NO — CID 115742260
N-(3,6-dihydro-2H-pyran-5-ylmethyl)-2,2-dimethylcyclopentan-1-amine (PubChem CID 115742260) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is N-(3,6-dihydro-2H-pyran-5-ylmethyl)-2,2-dimethylcyclopentan-1-amine.
| Compound Name | N-(3,6-dihydro-2H-pyran-5-ylmethyl)-2,2-dimethylcyclopentan-1-amine |
|---|---|
| PubChem CID | 115742260 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | N-(3,6-dihydro-2H-pyran-5-ylmethyl)-2,2-dimethylcyclopentan-1-amine |
| SMILES | CC1(C)CCCC1NCC1=CCCOC1 |
| InChI | InChI=1S/C13H23NO/c1-13(2)7-3-6-12(13)14-9-11-5-4-8-15-10-11/h5,12,14H,3-4,6-10H2,1-2H3 |
| InChIKey | PREGSLJURFEWEG-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|