C12H19NO — CID 115742302
N-(3,6-dihydro-2H-pyran-5-ylmethyl)cyclohex-2-en-1-amine (PubChem CID 115742302) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is N-(3,6-dihydro-2H-pyran-5-ylmethyl)cyclohex-2-en-1-amine.
| Compound Name | N-(3,6-dihydro-2H-pyran-5-ylmethyl)cyclohex-2-en-1-amine |
|---|---|
| PubChem CID | 115742302 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | N-(3,6-dihydro-2H-pyran-5-ylmethyl)cyclohex-2-en-1-amine |
| SMILES | C1=CC(NCC2=CCCOC2)CCC1 |
| InChI | InChI=1S/C12H19NO/c1-2-6-12(7-3-1)13-9-11-5-4-8-14-10-11/h2,5-6,12-13H,1,3-4,7-10H2 |
| InChIKey | XFYMKGHDCDMFQU-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|