About 5-[[(2-cyclopropyl-1,3-benzoxazol-5-yl)amino]methyl]thiophene-2-carbonitrile
5-[[(2-cyclopropyl-1,3-benzoxazol-5-yl)amino]methyl]thiophene-2-carbonitrile (PubChem CID 115743173) has the molecular formula C16H13N3OS
and a molecular weight of 295.37 g/mol. Its IUPAC name is 5-[[(2-cyclopropyl-1,3-benzoxazol-5-yl)amino]methyl]thiophene-2-carbonitrile.
Molecular Properties
| Compound Name | 5-[[(2-cyclopropyl-1,3-benzoxazol-5-yl)amino]methyl]thiophene-2-carbonitrile |
| PubChem CID | 115743173 |
| Molecular Formula | C16H13N3OS |
| Molecular Weight | 295.37 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | 5-[[(2-cyclopropyl-1,3-benzoxazol-5-yl)amino]methyl]thiophene-2-carbonitrile |
| SMILES | N#Cc1ccc(CNc2ccc3oc(C4CC4)nc3c2)s1 |
| InChI | InChI=1S/C16H13N3OS/c17-8-12-4-5-13(21-12)9-18-11-3-6-15-14(7-11)19-16(20-15)10-1-2-10/h3-7,10,18H,1-2,9H2 |
| InChIKey | PCUQNHZEUUAKJN-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.37 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[[(2-cyclopropyl-1,3-benzoxazol-5-yl)amino]methyl]thiophene-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[(2-cyclopropyl-1,3-benzoxazol-5-yl)amino]methyl]thiophene-2-carbonitrile?
The IUPAC name of 5-[[(2-cyclopropyl-1,3-benzoxazol-5-yl)amino]methyl]thiophene-2-carbonitrile (CID 115743173) is 5-[[(2-cyclopropyl-1,3-benzoxazol-5-yl)amino]methyl]thiophene-2-carbonitrile.
What is the SMILES notation for 5-[[(2-cyclopropyl-1,3-benzoxazol-5-yl)amino]methyl]thiophene-2-carbonitrile?
The canonical SMILES for 5-[[(2-cyclopropyl-1,3-benzoxazol-5-yl)amino]methyl]thiophene-2-carbonitrile is N#Cc1ccc(CNc2ccc3oc(C4CC4)nc3c2)s1.
What is the InChIKey of 5-[[(2-cyclopropyl-1,3-benzoxazol-5-yl)amino]methyl]thiophene-2-carbonitrile?
The InChIKey is PCUQNHZEUUAKJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13N3OS/c17-8-12-4-5-13(21-12)9-18-11-3-6-15-14(7-11)19-16(20-15)10-1-2-10/h3-7,10,18H,1-2,9H2.
What are the key properties of 5-[[(2-cyclopropyl-1,3-benzoxazol-5-yl)amino]methyl]thiophene-2-carbonitrile?
5-[[(2-cyclopropyl-1,3-benzoxazol-5-yl)amino]methyl]thiophene-2-carbonitrile has a molecular weight of 295.37 g/mol, XLogP of 4.25, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[(2-cyclopropyl-1,3-benzoxazol-5-yl)amino]methyl]thiophene-2-carbonitrile is sourced from PubChem (CID 115743173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).