C18H17F6NO — CID 11574384
2-[4-[benzyl(ethyl)amino]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 11574384) has the molecular formula C18H17F6NO and a molecular weight of 377.33 g/mol. Its IUPAC name is 2-[4-[benzyl(ethyl)amino]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[4-[benzyl(ethyl)amino]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 11574384 |
| Molecular Formula | C18H17F6NO |
| Molecular Weight | 377.33 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | 2-[4-[benzyl(ethyl)amino]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | CCN(Cc1ccccc1)c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H17F6NO/c1-2-25(12-13-6-4-3-5-7-13)15-10-8-14(9-11-15)16(26,17(19,20)21)18(22,23)24/h3-11,26H,2,12H2,1H3 |
| InChIKey | UWRRECCPOPWQFF-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.33 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|