C16H20ClN7O2 — CID 11574400
3,5-diamino-6-chloro-N-[N'-[4-(2-hydroxyphenyl)butyl]carbamimidoyl]pyrazine-2-carboxamide (PubChem CID 11574400) has the molecular formula C16H20ClN7O2 and a molecular weight of 377.84 g/mol. Its IUPAC name is 3,5-diamino-6-chloro-N-[N'-[4-(2-hydroxyphenyl)butyl]carbamimidoyl]pyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-6-chloro-N-[N'-[4-(2-hydroxyphenyl)butyl]carbamimidoyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 11574400 |
| Molecular Formula | C16H20ClN7O2 |
| Molecular Weight | 377.84 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | 3,5-diamino-6-chloro-N-[N'-[4-(2-hydroxyphenyl)butyl]carbamimidoyl]pyrazine-2-carboxamide |
| SMILES | N/C(=N\CCCCc1ccccc1O)NC(=O)c1nc(Cl)c(N)nc1N |
| InChI | InChI=1S/C16H20ClN7O2/c17-12-14(19)23-13(18)11(22-12)15(26)24-16(20)21-8-4-3-6-9-5-1-2-7-10(9)25/h1-2,5,7,25H,3-4,6,8H2,(H4,18,19,23)(H3,20,21,24,26) |
| InChIKey | DYHBHAJCZQWTBS-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 165.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.84 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|