C11H16N2O — CID 115744703
2-[(5-methyl-2-pyridinyl)-prop-2-enylamino]ethanol (PubChem CID 115744703) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is 2-[(5-methyl-2-pyridinyl)-prop-2-enylamino]ethanol.
| Compound Name | 2-[(5-methyl-2-pyridinyl)-prop-2-enylamino]ethanol |
|---|---|
| PubChem CID | 115744703 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | 2-[(5-methyl-2-pyridinyl)-prop-2-enylamino]ethanol |
| SMILES | C=CCN(CCO)c1ccc(C)cn1 |
| InChI | InChI=1S/C11H16N2O/c1-3-6-13(7-8-14)11-5-4-10(2)9-12-11/h3-5,9,14H,1,6-8H2,2H3 |
| InChIKey | NWVYRIITBPKEAN-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|