C21H17N7O — CID 11574515
6-[(2-methyl-1,2,4-triazol-3-yl)methoxy]-3,7-diphenyl-[1,2,4]triazolo[4,3-b]pyridazine (PubChem CID 11574515) has the molecular formula C21H17N7O and a molecular weight of 383.42 g/mol. Its IUPAC name is 6-[(2-methyl-1,2,4-triazol-3-yl)methoxy]-3,7-diphenyl-[1,2,4]triazolo[4,3-b]pyridazine.
| Compound Name | 6-[(2-methyl-1,2,4-triazol-3-yl)methoxy]-3,7-diphenyl-[1,2,4]triazolo[4,3-b]pyridazine |
|---|---|
| PubChem CID | 11574515 |
| Molecular Formula | C21H17N7O |
| Molecular Weight | 383.42 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 6-[(2-methyl-1,2,4-triazol-3-yl)methoxy]-3,7-diphenyl-[1,2,4]triazolo[4,3-b]pyridazine |
| SMILES | Cn1ncnc1COc1nn2c(-c3ccccc3)nnc2cc1-c1ccccc1 |
| InChI | InChI=1S/C21H17N7O/c1-27-19(22-14-23-27)13-29-21-17(15-8-4-2-5-9-15)12-18-24-25-20(28(18)26-21)16-10-6-3-7-11-16/h2-12,14H,13H2,1H3 |
| InChIKey | LHMYCKKRCBXCBI-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 83.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.42 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |