C21H23N5O5S — CID 1157459
4-methoxy-N'-[2-[[5-[(2-methoxyphenoxy)methyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]benzohydrazide (PubChem CID 1157459) has the molecular formula C21H23N5O5S and a molecular weight of 457.51 g/mol. Its IUPAC name is 4-methoxy-N'-[2-[[5-[(2-methoxyphenoxy)methyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]benzohydrazide.
| Compound Name | 4-methoxy-N'-[2-[[5-[(2-methoxyphenoxy)methyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]benzohydrazide |
|---|---|
| PubChem CID | 1157459 |
| Molecular Formula | C21H23N5O5S |
| Molecular Weight | 457.51 g/mol |
| Exact Mass | 457.14 |
| IUPAC Name | 4-methoxy-N'-[2-[[5-[(2-methoxyphenoxy)methyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]benzohydrazide |
| SMILES | COc1ccc(C(=O)NNC(=O)CSc2nnc(COc3ccccc3OC)n2C)cc1 |
| InChI | InChI=1S/C21H23N5O5S/c1-26-18(12-31-17-7-5-4-6-16(17)30-3)22-25-21(26)32-13-19(27)23-24-20(28)14-8-10-15(29-2)11-9-14/h4-11H,12-13H2,1-3H3,(H,23,27)(H,24,28) |
| InChIKey | VUZNVDLJKLSSRB-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 116.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.51 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|