C16H15BrFNO — CID 115745964
N-(2-bromo-4,6-dimethylphenyl)-4-fluoro-2-methylbenzamide (PubChem CID 115745964) has the molecular formula C16H15BrFNO and a molecular weight of 336.20 g/mol. Its IUPAC name is N-(2-bromo-4,6-dimethylphenyl)-4-fluoro-2-methylbenzamide.
| Compound Name | N-(2-bromo-4,6-dimethylphenyl)-4-fluoro-2-methylbenzamide |
|---|---|
| PubChem CID | 115745964 |
| Molecular Formula | C16H15BrFNO |
| Molecular Weight | 336.20 g/mol |
| Exact Mass | 335.03 |
| IUPAC Name | N-(2-bromo-4,6-dimethylphenyl)-4-fluoro-2-methylbenzamide |
| SMILES | Cc1cc(C)c(NC(=O)c2ccc(F)cc2C)c(Br)c1 |
| InChI | InChI=1S/C16H15BrFNO/c1-9-6-11(3)15(14(17)7-9)19-16(20)13-5-4-12(18)8-10(13)2/h4-8H,1-3H3,(H,19,20) |
| InChIKey | DXDOFGTXNHORHC-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.20 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |