C17H10F6N2O2 — CID 11574601
1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indazole-3-carboxylic acid (PubChem CID 11574601) has the molecular formula C17H10F6N2O2 and a molecular weight of 388.27 g/mol. Its IUPAC name is 1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indazole-3-carboxylic acid.
| Compound Name | 1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indazole-3-carboxylic acid |
|---|---|
| PubChem CID | 11574601 |
| Molecular Formula | C17H10F6N2O2 |
| Molecular Weight | 388.27 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | 1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indazole-3-carboxylic acid |
| SMILES | O=C(O)c1nn(Cc2ccc(C(F)(F)F)cc2C(F)(F)F)c2ccccc12 |
| InChI | InChI=1S/C17H10F6N2O2/c18-16(19,20)10-6-5-9(12(7-10)17(21,22)23)8-25-13-4-2-1-3-11(13)14(24-25)15(26)27/h1-7H,8H2,(H,26,27) |
| InChIKey | WKKXMHGRXDZIMS-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.27 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |