C15H21NO3 — CID 115746439
[3-(2-hydroxyethyl)pyrrolidin-1-yl]-[4-(methoxymethyl)phenyl]methanone (PubChem CID 115746439) has the molecular formula C15H21NO3 and a molecular weight of 263.34 g/mol. Its IUPAC name is [3-(2-hydroxyethyl)pyrrolidin-1-yl]-[4-(methoxymethyl)phenyl]methanone.
| Compound Name | [3-(2-hydroxyethyl)pyrrolidin-1-yl]-[4-(methoxymethyl)phenyl]methanone |
|---|---|
| PubChem CID | 115746439 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | [3-(2-hydroxyethyl)pyrrolidin-1-yl]-[4-(methoxymethyl)phenyl]methanone |
| SMILES | COCc1ccc(C(=O)N2CCC(CCO)C2)cc1 |
| InChI | InChI=1S/C15H21NO3/c1-19-11-13-2-4-14(5-3-13)15(18)16-8-6-12(10-16)7-9-17/h2-5,12,17H,6-11H2,1H3 |
| InChIKey | GKUWHRSMBGSQIU-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |