About N-(imidazo[1,2-a]pyrimidin-3-ylmethyl)pentan-2-amine
N-(imidazo[1,2-a]pyrimidin-3-ylmethyl)pentan-2-amine (PubChem CID 115747108) has the molecular formula C12H18N4
and a molecular weight of 218.30 g/mol. Its IUPAC name is N-(imidazo[1,2-a]pyrimidin-3-ylmethyl)pentan-2-amine.
Molecular Properties
| Compound Name | N-(imidazo[1,2-a]pyrimidin-3-ylmethyl)pentan-2-amine |
| PubChem CID | 115747108 |
| Molecular Formula | C12H18N4 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | N-(imidazo[1,2-a]pyrimidin-3-ylmethyl)pentan-2-amine |
| SMILES | CCCC(C)NCc1cnc2ncccn12 |
| InChI | InChI=1S/C12H18N4/c1-3-5-10(2)14-8-11-9-15-12-13-6-4-7-16(11)12/h4,6-7,9-10,14H,3,5,8H2,1-2H3 |
| InChIKey | DKXXNAIWYFCCNC-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(imidazo[1,2-a]pyrimidin-3-ylmethyl)pentan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(imidazo[1,2-a]pyrimidin-3-ylmethyl)pentan-2-amine?
The IUPAC name of N-(imidazo[1,2-a]pyrimidin-3-ylmethyl)pentan-2-amine (CID 115747108) is N-(imidazo[1,2-a]pyrimidin-3-ylmethyl)pentan-2-amine.
What is the SMILES notation for N-(imidazo[1,2-a]pyrimidin-3-ylmethyl)pentan-2-amine?
The canonical SMILES for N-(imidazo[1,2-a]pyrimidin-3-ylmethyl)pentan-2-amine is CCCC(C)NCc1cnc2ncccn12.
What is the InChIKey of N-(imidazo[1,2-a]pyrimidin-3-ylmethyl)pentan-2-amine?
The InChIKey is DKXXNAIWYFCCNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N4/c1-3-5-10(2)14-8-11-9-15-12-13-6-4-7-16(11)12/h4,6-7,9-10,14H,3,5,8H2,1-2H3.
What are the key properties of N-(imidazo[1,2-a]pyrimidin-3-ylmethyl)pentan-2-amine?
N-(imidazo[1,2-a]pyrimidin-3-ylmethyl)pentan-2-amine has a molecular weight of 218.30 g/mol, XLogP of 2.01, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(imidazo[1,2-a]pyrimidin-3-ylmethyl)pentan-2-amine is sourced from PubChem (CID 115747108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).