C11H16N4O — CID 115747146
2-ethoxy-N-(imidazo[1,2-a]pyrimidin-3-ylmethyl)ethanamine (PubChem CID 115747146) has the molecular formula C11H16N4O and a molecular weight of 220.28 g/mol. Its IUPAC name is 2-ethoxy-N-(imidazo[1,2-a]pyrimidin-3-ylmethyl)ethanamine.
| Compound Name | 2-ethoxy-N-(imidazo[1,2-a]pyrimidin-3-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 115747146 |
| Molecular Formula | C11H16N4O |
| Molecular Weight | 220.28 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | 2-ethoxy-N-(imidazo[1,2-a]pyrimidin-3-ylmethyl)ethanamine |
| SMILES | CCOCCNCc1cnc2ncccn12 |
| InChI | InChI=1S/C11H16N4O/c1-2-16-7-5-12-8-10-9-14-11-13-4-3-6-15(10)11/h3-4,6,9,12H,2,5,7-8H2,1H3 |
| InChIKey | ZYIIAJNBCSAIMI-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 51.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.28 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|