About 2-ethoxy-N-(imidazo[1,2-a]pyrimidin-3-ylmethyl)ethanamine
2-ethoxy-N-(imidazo[1,2-a]pyrimidin-3-ylmethyl)ethanamine (PubChem CID 115747146) has the molecular formula C11H16N4O
and a molecular weight of 220.28 g/mol. Its IUPAC name is 2-ethoxy-N-(imidazo[1,2-a]pyrimidin-3-ylmethyl)ethanamine.
Molecular Properties
| Compound Name | 2-ethoxy-N-(imidazo[1,2-a]pyrimidin-3-ylmethyl)ethanamine |
| PubChem CID | 115747146 |
| Molecular Formula | C11H16N4O |
| Molecular Weight | 220.28 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | 2-ethoxy-N-(imidazo[1,2-a]pyrimidin-3-ylmethyl)ethanamine |
| SMILES | CCOCCNCc1cnc2ncccn12 |
| InChI | InChI=1S/C11H16N4O/c1-2-16-7-5-12-8-10-9-14-11-13-4-3-6-15(10)11/h3-4,6,9,12H,2,5,7-8H2,1H3 |
| InChIKey | ZYIIAJNBCSAIMI-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 51.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.28 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-ethoxy-N-(imidazo[1,2-a]pyrimidin-3-ylmethyl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxy-N-(imidazo[1,2-a]pyrimidin-3-ylmethyl)ethanamine?
The IUPAC name of 2-ethoxy-N-(imidazo[1,2-a]pyrimidin-3-ylmethyl)ethanamine (CID 115747146) is 2-ethoxy-N-(imidazo[1,2-a]pyrimidin-3-ylmethyl)ethanamine.
What is the SMILES notation for 2-ethoxy-N-(imidazo[1,2-a]pyrimidin-3-ylmethyl)ethanamine?
The canonical SMILES for 2-ethoxy-N-(imidazo[1,2-a]pyrimidin-3-ylmethyl)ethanamine is CCOCCNCc1cnc2ncccn12.
What is the InChIKey of 2-ethoxy-N-(imidazo[1,2-a]pyrimidin-3-ylmethyl)ethanamine?
The InChIKey is ZYIIAJNBCSAIMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N4O/c1-2-16-7-5-12-8-10-9-14-11-13-4-3-6-15(10)11/h3-4,6,9,12H,2,5,7-8H2,1H3.
What are the key properties of 2-ethoxy-N-(imidazo[1,2-a]pyrimidin-3-ylmethyl)ethanamine?
2-ethoxy-N-(imidazo[1,2-a]pyrimidin-3-ylmethyl)ethanamine has a molecular weight of 220.28 g/mol, XLogP of 0.86, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxy-N-(imidazo[1,2-a]pyrimidin-3-ylmethyl)ethanamine is sourced from PubChem (CID 115747146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).