C12H22N2O2 — CID 115747424
2-(3,6-dihydro-2H-pyran-5-ylmethylamino)-N,3-dimethylbutanamide (PubChem CID 115747424) has the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. Its IUPAC name is 2-(3,6-dihydro-2H-pyran-5-ylmethylamino)-N,3-dimethylbutanamide.
| Compound Name | 2-(3,6-dihydro-2H-pyran-5-ylmethylamino)-N,3-dimethylbutanamide |
|---|---|
| PubChem CID | 115747424 |
| Molecular Formula | C12H22N2O2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | 2-(3,6-dihydro-2H-pyran-5-ylmethylamino)-N,3-dimethylbutanamide |
| SMILES | CNC(=O)C(NCC1=CCCOC1)C(C)C |
| InChI | InChI=1S/C12H22N2O2/c1-9(2)11(12(15)13-3)14-7-10-5-4-6-16-8-10/h5,9,11,14H,4,6-8H2,1-3H3,(H,13,15) |
| InChIKey | PJUXFJKJSWHXKY-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|