About 8-(1-benzofuran-3-yl)-3,7-dihydropurine-2,6-dione
8-(1-benzofuran-3-yl)-3,7-dihydropurine-2,6-dione (PubChem CID 115749614) has the molecular formula C13H8N4O3
and a molecular weight of 268.23 g/mol. Its IUPAC name is 8-(1-benzofuran-3-yl)-3,7-dihydropurine-2,6-dione.
Molecular Properties
| Compound Name | 8-(1-benzofuran-3-yl)-3,7-dihydropurine-2,6-dione |
| PubChem CID | 115749614 |
| Molecular Formula | C13H8N4O3 |
| Molecular Weight | 268.23 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | 8-(1-benzofuran-3-yl)-3,7-dihydropurine-2,6-dione |
| SMILES | O=c1[nH]c(=O)c2[nH]c(-c3coc4ccccc34)nc2[nH]1 |
| InChI | InChI=1S/C13H8N4O3/c18-12-9-11(16-13(19)17-12)15-10(14-9)7-5-20-8-4-2-1-3-6(7)8/h1-5H,(H3,14,15,16,17,18,19) |
| InChIKey | PWSDLVMLTIAPEY-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 107.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.23 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-(1-benzofuran-3-yl)-3,7-dihydropurine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(1-benzofuran-3-yl)-3,7-dihydropurine-2,6-dione?
The IUPAC name of 8-(1-benzofuran-3-yl)-3,7-dihydropurine-2,6-dione (CID 115749614) is 8-(1-benzofuran-3-yl)-3,7-dihydropurine-2,6-dione.
What is the SMILES notation for 8-(1-benzofuran-3-yl)-3,7-dihydropurine-2,6-dione?
The canonical SMILES for 8-(1-benzofuran-3-yl)-3,7-dihydropurine-2,6-dione is O=c1[nH]c(=O)c2[nH]c(-c3coc4ccccc34)nc2[nH]1.
What is the InChIKey of 8-(1-benzofuran-3-yl)-3,7-dihydropurine-2,6-dione?
The InChIKey is PWSDLVMLTIAPEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8N4O3/c18-12-9-11(16-13(19)17-12)15-10(14-9)7-5-20-8-4-2-1-3-6(7)8/h1-5H,(H3,14,15,16,17,18,19).
What are the key properties of 8-(1-benzofuran-3-yl)-3,7-dihydropurine-2,6-dione?
8-(1-benzofuran-3-yl)-3,7-dihydropurine-2,6-dione has a molecular weight of 268.23 g/mol, XLogP of 1.35, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(1-benzofuran-3-yl)-3,7-dihydropurine-2,6-dione is sourced from PubChem (CID 115749614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).