C5H6FNOS — CID 115749769
3-(2-fluoroethyl)-1,3-thiazol-2-one (PubChem CID 115749769) has the molecular formula C5H6FNOS and a molecular weight of 147.17 g/mol. Its IUPAC name is 3-(2-fluoroethyl)-1,3-thiazol-2-one.
| Compound Name | 3-(2-fluoroethyl)-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 115749769 |
| Molecular Formula | C5H6FNOS |
| Molecular Weight | 147.17 g/mol |
| Exact Mass | 147.02 |
| IUPAC Name | 3-(2-fluoroethyl)-1,3-thiazol-2-one |
| SMILES | O=c1sccn1CCF |
| InChI | InChI=1S/C5H6FNOS/c6-1-2-7-3-4-9-5(7)8/h3-4H,1-2H2 |
| InChIKey | IIXHZSOIBMFUOO-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.17 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |