C24H23NO5 — CID 11575006
(5R,6R)-11,13-dimethoxy-7,7-dimethyl-8-oxa-2-azapentacyclo[12.8.0.03,12.04,9.015,20]docosa-1,3,9,11,13,15,17,19,21-nonaene-5,6-diol (PubChem CID 11575006) has the molecular formula C24H23NO5 and a molecular weight of 405.45 g/mol. Its IUPAC name is (5R,6R)-11,13-dimethoxy-7,7-dimethyl-8-oxa-2-azapentacyclo[12.8.0.03,12.04,9.015,20]docosa-1,3,9,11,13,15,17,19,21-nonaene-5,6-diol.
| Compound Name | (5R,6R)-11,13-dimethoxy-7,7-dimethyl-8-oxa-2-azapentacyclo[12.8.0.03,12.04,9.015,20]docosa-1,3,9,11,13,15,17,19,21-nonaene-5,6-diol |
|---|---|
| PubChem CID | 11575006 |
| Molecular Formula | C24H23NO5 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | (5R,6R)-11,13-dimethoxy-7,7-dimethyl-8-oxa-2-azapentacyclo[12.8.0.03,12.04,9.015,20]docosa-1,3,9,11,13,15,17,19,21-nonaene-5,6-diol |
| SMILES | COc1cc2c(c3nc4ccc5ccccc5c4c(OC)c13)[C@@H](O)[C@@H](O)C(C)(C)O2 |
| InChI | InChI=1S/C24H23NO5/c1-24(2)23(27)21(26)18-16(30-24)11-15(28-3)19-20(18)25-14-10-9-12-7-5-6-8-13(12)17(14)22(19)29-4/h5-11,21,23,26-27H,1-4H3/t21-,23-/m1/s1 |
| InChIKey | YGRXFYDOCZKLIJ-FYYLOGMGSA-N |
| XLogP | 4.12 |
| TPSA | 81.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|