C12H23N3O3S — CID 115752221
N-methyl-N-(2-oxo-2-piperazin-1-ylethyl)cyclopentanesulfonamide (PubChem CID 115752221) has the molecular formula C12H23N3O3S and a molecular weight of 289.40 g/mol. Its IUPAC name is N-methyl-N-(2-oxo-2-piperazin-1-ylethyl)cyclopentanesulfonamide.
| Compound Name | N-methyl-N-(2-oxo-2-piperazin-1-ylethyl)cyclopentanesulfonamide |
|---|---|
| PubChem CID | 115752221 |
| Molecular Formula | C12H23N3O3S |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | N-methyl-N-(2-oxo-2-piperazin-1-ylethyl)cyclopentanesulfonamide |
| SMILES | CN(CC(=O)N1CCNCC1)S(=O)(=O)C1CCCC1 |
| InChI | InChI=1S/C12H23N3O3S/c1-14(19(17,18)11-4-2-3-5-11)10-12(16)15-8-6-13-7-9-15/h11,13H,2-10H2,1H3 |
| InChIKey | PYTVBWIESHTJRQ-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |