About N-[4-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]phenyl]-4-propan-2-yloxybenzamide
N-[4-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]phenyl]-4-propan-2-yloxybenzamide (PubChem CID 1157527) has the molecular formula C21H23N3O5S
and a molecular weight of 429.50 g/mol. Its IUPAC name is N-[4-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]phenyl]-4-propan-2-yloxybenzamide.
Molecular Properties
| Compound Name | N-[4-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]phenyl]-4-propan-2-yloxybenzamide |
| PubChem CID | 1157527 |
| Molecular Formula | C21H23N3O5S |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | N-[4-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]phenyl]-4-propan-2-yloxybenzamide |
| SMILES | Cc1noc(NS(=O)(=O)c2ccc(NC(=O)c3ccc(OC(C)C)cc3)cc2)c1C |
| InChI | InChI=1S/C21H23N3O5S/c1-13(2)28-18-9-5-16(6-10-18)20(25)22-17-7-11-19(12-8-17)30(26,27)24-21-14(3)15(4)23-29-21/h5-13,24H,1-4H3,(H,22,25) |
| InChIKey | GENUYQNIXNCRSZ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 110.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[4-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]phenyl]-4-propan-2-yloxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]phenyl]-4-propan-2-yloxybenzamide?
The IUPAC name of N-[4-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]phenyl]-4-propan-2-yloxybenzamide (CID 1157527) is N-[4-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]phenyl]-4-propan-2-yloxybenzamide.
What is the SMILES notation for N-[4-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]phenyl]-4-propan-2-yloxybenzamide?
The canonical SMILES for N-[4-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]phenyl]-4-propan-2-yloxybenzamide is Cc1noc(NS(=O)(=O)c2ccc(NC(=O)c3ccc(OC(C)C)cc3)cc2)c1C.
What is the InChIKey of N-[4-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]phenyl]-4-propan-2-yloxybenzamide?
The InChIKey is GENUYQNIXNCRSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23N3O5S/c1-13(2)28-18-9-5-16(6-10-18)20(25)22-17-7-11-19(12-8-17)30(26,27)24-21-14(3)15(4)23-29-21/h5-13,24H,1-4H3,(H,22,25).
What are the key properties of N-[4-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]phenyl]-4-propan-2-yloxybenzamide?
N-[4-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]phenyl]-4-propan-2-yloxybenzamide has a molecular weight of 429.50 g/mol, XLogP of 4.13, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]phenyl]-4-propan-2-yloxybenzamide is sourced from PubChem (CID 1157527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).