C12H20N2S2 — CID 115753114
N-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethyl]thian-3-amine (PubChem CID 115753114) has the molecular formula C12H20N2S2 and a molecular weight of 256.44 g/mol. Its IUPAC name is N-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethyl]thian-3-amine.
| Compound Name | N-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethyl]thian-3-amine |
|---|---|
| PubChem CID | 115753114 |
| Molecular Formula | C12H20N2S2 |
| Molecular Weight | 256.44 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | N-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethyl]thian-3-amine |
| SMILES | Cc1nc(C(C)NC2CCCSC2)c(C)s1 |
| InChI | InChI=1S/C12H20N2S2/c1-8(12-9(2)16-10(3)14-12)13-11-5-4-6-15-7-11/h8,11,13H,4-7H2,1-3H3 |
| InChIKey | AMNUJZCBGGMXJK-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.44 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |