C20H20F2N4O2S — CID 11575315
(2Z)-1-[2-(3-aminopropyl)-5-(2,5-difluorophenyl)-2-phenyl-1,3,4-thiadiazol-3-yl]-2-hydroxyiminopropan-1-one (PubChem CID 11575315) has the molecular formula C20H20F2N4O2S and a molecular weight of 418.47 g/mol. Its IUPAC name is (2Z)-1-[2-(3-aminopropyl)-5-(2,5-difluorophenyl)-2-phenyl-1,3,4-thiadiazol-3-yl]-2-hydroxyiminopropan-1-one.
| Compound Name | (2Z)-1-[2-(3-aminopropyl)-5-(2,5-difluorophenyl)-2-phenyl-1,3,4-thiadiazol-3-yl]-2-hydroxyiminopropan-1-one |
|---|---|
| PubChem CID | 11575315 |
| Molecular Formula | C20H20F2N4O2S |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | (2Z)-1-[2-(3-aminopropyl)-5-(2,5-difluorophenyl)-2-phenyl-1,3,4-thiadiazol-3-yl]-2-hydroxyiminopropan-1-one |
| SMILES | C/C(=N/O)C(=O)N1N=C(c2cc(F)ccc2F)SC1(CCCN)c1ccccc1 |
| InChI | InChI=1S/C20H20F2N4O2S/c1-13(25-28)19(27)26-20(10-5-11-23,14-6-3-2-4-7-14)29-18(24-26)16-12-15(21)8-9-17(16)22/h2-4,6-9,12,28H,5,10-11,23H2,1H3/b25-13- |
| InChIKey | WTQNUOCZURTJPH-MXAYSNPKSA-N |
| XLogP | 3.64 |
| TPSA | 91.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|