C15H25NO4S — CID 115754460
N-(2-hydroxypentyl)-3-methyl-4-propan-2-yloxybenzenesulfonamide (PubChem CID 115754460) has the molecular formula C15H25NO4S and a molecular weight of 315.44 g/mol. Its IUPAC name is N-(2-hydroxypentyl)-3-methyl-4-propan-2-yloxybenzenesulfonamide.
| Compound Name | N-(2-hydroxypentyl)-3-methyl-4-propan-2-yloxybenzenesulfonamide |
|---|---|
| PubChem CID | 115754460 |
| Molecular Formula | C15H25NO4S |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | N-(2-hydroxypentyl)-3-methyl-4-propan-2-yloxybenzenesulfonamide |
| SMILES | CCCC(O)CNS(=O)(=O)c1ccc(OC(C)C)c(C)c1 |
| InChI | InChI=1S/C15H25NO4S/c1-5-6-13(17)10-16-21(18,19)14-7-8-15(12(4)9-14)20-11(2)3/h7-9,11,13,16-17H,5-6,10H2,1-4H3 |
| InChIKey | IOVUBNQRRMDNOZ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |