C22H32N8O — CID 11575452
5-(4-aminopiperidin-1-yl)-1-(2-ethoxyethyl)-3-ethyl-N-(4-methyl-2-pyridinyl)pyrazolo[4,5-d]pyrimidin-7-amine (PubChem CID 11575452) has the molecular formula C22H32N8O and a molecular weight of 424.55 g/mol. Its IUPAC name is 5-(4-aminopiperidin-1-yl)-1-(2-ethoxyethyl)-3-ethyl-N-(4-methyl-2-pyridinyl)pyrazolo[4,5-d]pyrimidin-7-amine.
| Compound Name | 5-(4-aminopiperidin-1-yl)-1-(2-ethoxyethyl)-3-ethyl-N-(4-methyl-2-pyridinyl)pyrazolo[4,5-d]pyrimidin-7-amine |
|---|---|
| PubChem CID | 11575452 |
| Molecular Formula | C22H32N8O |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.27 |
| IUPAC Name | 5-(4-aminopiperidin-1-yl)-1-(2-ethoxyethyl)-3-ethyl-N-(4-methyl-2-pyridinyl)pyrazolo[4,5-d]pyrimidin-7-amine |
| SMILES | CCOCCn1nc(CC)c2nc(N3CCC(N)CC3)nc(Nc3cc(C)ccn3)c21 |
| InChI | InChI=1S/C22H32N8O/c1-4-17-19-20(30(28-17)12-13-31-5-2)21(25-18-14-15(3)6-9-24-18)27-22(26-19)29-10-7-16(23)8-11-29/h6,9,14,16H,4-5,7-8,10-13,23H2,1-3H3,(H,24,25,26,27) |
| InChIKey | LASVKJLQJACNOV-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 107.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|