About 5,7-dichloro-3-methyl-3-(3-phenylmethoxyphenyl)-1H-quinoline-2,4-dione
5,7-dichloro-3-methyl-3-(3-phenylmethoxyphenyl)-1H-quinoline-2,4-dione (PubChem CID 11575479) has the molecular formula C23H17Cl2NO3
and a molecular weight of 426.30 g/mol. Its IUPAC name is 5,7-dichloro-3-methyl-3-(3-phenylmethoxyphenyl)-1H-quinoline-2,4-dione.
Molecular Properties
| Compound Name | 5,7-dichloro-3-methyl-3-(3-phenylmethoxyphenyl)-1H-quinoline-2,4-dione |
| PubChem CID | 11575479 |
| Molecular Formula | C23H17Cl2NO3 |
| Molecular Weight | 426.30 g/mol |
| Exact Mass | 425.06 |
| IUPAC Name | 5,7-dichloro-3-methyl-3-(3-phenylmethoxyphenyl)-1H-quinoline-2,4-dione |
| SMILES | CC1(c2cccc(OCc3ccccc3)c2)C(=O)Nc2cc(Cl)cc(Cl)c2C1=O |
| InChI | InChI=1S/C23H17Cl2NO3/c1-23(21(27)20-18(25)11-16(24)12-19(20)26-22(23)28)15-8-5-9-17(10-15)29-13-14-6-3-2-4-7-14/h2-12H,13H2,1H3,(H,26,28) |
| InChIKey | QASCBWTWFDWZJI-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 426.30 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 5,7-dichloro-3-methyl-3-(3-phenylmethoxyphenyl)-1H-quinoline-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dichloro-3-methyl-3-(3-phenylmethoxyphenyl)-1H-quinoline-2,4-dione?
The IUPAC name of 5,7-dichloro-3-methyl-3-(3-phenylmethoxyphenyl)-1H-quinoline-2,4-dione (CID 11575479) is 5,7-dichloro-3-methyl-3-(3-phenylmethoxyphenyl)-1H-quinoline-2,4-dione.
What is the SMILES notation for 5,7-dichloro-3-methyl-3-(3-phenylmethoxyphenyl)-1H-quinoline-2,4-dione?
The canonical SMILES for 5,7-dichloro-3-methyl-3-(3-phenylmethoxyphenyl)-1H-quinoline-2,4-dione is CC1(c2cccc(OCc3ccccc3)c2)C(=O)Nc2cc(Cl)cc(Cl)c2C1=O.
What is the InChIKey of 5,7-dichloro-3-methyl-3-(3-phenylmethoxyphenyl)-1H-quinoline-2,4-dione?
The InChIKey is QASCBWTWFDWZJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H17Cl2NO3/c1-23(21(27)20-18(25)11-16(24)12-19(20)26-22(23)28)15-8-5-9-17(10-15)29-13-14-6-3-2-4-7-14/h2-12H,13H2,1H3,(H,26,28).
What are the key properties of 5,7-dichloro-3-methyl-3-(3-phenylmethoxyphenyl)-1H-quinoline-2,4-dione?
5,7-dichloro-3-methyl-3-(3-phenylmethoxyphenyl)-1H-quinoline-2,4-dione has a molecular weight of 426.30 g/mol, XLogP of 5.67, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dichloro-3-methyl-3-(3-phenylmethoxyphenyl)-1H-quinoline-2,4-dione is sourced from PubChem (CID 11575479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).