C21H23ClN6O2 — CID 11575498
8-[1-[(3-chlorophenyl)methyl]pyrazol-4-yl]-1,3-dipropyl-7H-purine-2,6-dione (PubChem CID 11575498) has the molecular formula C21H23ClN6O2 and a molecular weight of 426.91 g/mol. Its IUPAC name is 8-[1-[(3-chlorophenyl)methyl]pyrazol-4-yl]-1,3-dipropyl-7H-purine-2,6-dione.
| Compound Name | 8-[1-[(3-chlorophenyl)methyl]pyrazol-4-yl]-1,3-dipropyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 11575498 |
| Molecular Formula | C21H23ClN6O2 |
| Molecular Weight | 426.91 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | 8-[1-[(3-chlorophenyl)methyl]pyrazol-4-yl]-1,3-dipropyl-7H-purine-2,6-dione |
| SMILES | CCCn1c(=O)c2[nH]c(-c3cnn(Cc4cccc(Cl)c4)c3)nc2n(CCC)c1=O |
| InChI | InChI=1S/C21H23ClN6O2/c1-3-8-27-19-17(20(29)28(9-4-2)21(27)30)24-18(25-19)15-11-23-26(13-15)12-14-6-5-7-16(22)10-14/h5-7,10-11,13H,3-4,8-9,12H2,1-2H3,(H,24,25) |
| InChIKey | BHVNIIMPUODVIW-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 90.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.91 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |