C27H46O2Si — CID 11575596
(4E,8E,12E)-5,9-dimethyl-2-methylidene-14-tri(propan-2-yl)silyloxypentadeca-4,8,12,14-tetraenal (PubChem CID 11575596) has the molecular formula C27H46O2Si and a molecular weight of 430.75 g/mol. Its IUPAC name is (4E,8E,12E)-5,9-dimethyl-2-methylidene-14-tri(propan-2-yl)silyloxypentadeca-4,8,12,14-tetraenal.
| Compound Name | (4E,8E,12E)-5,9-dimethyl-2-methylidene-14-tri(propan-2-yl)silyloxypentadeca-4,8,12,14-tetraenal |
|---|---|
| PubChem CID | 11575596 |
| Molecular Formula | C27H46O2Si |
| Molecular Weight | 430.75 g/mol |
| Exact Mass | 430.33 |
| IUPAC Name | (4E,8E,12E)-5,9-dimethyl-2-methylidene-14-tri(propan-2-yl)silyloxypentadeca-4,8,12,14-tetraenal |
| SMILES | C=C(C=O)C/C=C(\C)CC/C=C(\C)CC/C=C/C(=C)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C27H46O2Si/c1-21(2)30(22(3)4,23(5)6)29-27(10)17-12-11-14-24(7)15-13-16-25(8)18-19-26(9)20-28/h12,15,17-18,20-23H,9-11,13-14,16,19H2,1-8H3/b17-12+,24-15+,25-18+ |
| InChIKey | BMDHPRAPKKRHFK-NINGODMGSA-N |
| XLogP | 8.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.75 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|