About [7-ethenyl-2-(2-fluoro-4-sulfooxyphenyl)-1,3-benzoxazol-5-yl] hydrogen sulfate
[7-ethenyl-2-(2-fluoro-4-sulfooxyphenyl)-1,3-benzoxazol-5-yl] hydrogen sulfate (PubChem CID 11575603) has the molecular formula C15H10FNO9S2
and a molecular weight of 431.38 g/mol. Its IUPAC name is [7-ethenyl-2-(2-fluoro-4-sulfooxyphenyl)-1,3-benzoxazol-5-yl] hydrogen sulfate.
Molecular Properties
| Compound Name | [7-ethenyl-2-(2-fluoro-4-sulfooxyphenyl)-1,3-benzoxazol-5-yl] hydrogen sulfate |
| PubChem CID | 11575603 |
| Molecular Formula | C15H10FNO9S2 |
| Molecular Weight | 431.38 g/mol |
| Exact Mass | 430.98 |
| IUPAC Name | [7-ethenyl-2-(2-fluoro-4-sulfooxyphenyl)-1,3-benzoxazol-5-yl] hydrogen sulfate |
| SMILES | C=Cc1cc(OS(=O)(=O)O)cc2nc(-c3ccc(OS(=O)(=O)O)cc3F)oc12 |
| InChI | InChI=1S/C15H10FNO9S2/c1-2-8-5-10(26-28(21,22)23)7-13-14(8)24-15(17-13)11-4-3-9(6-12(11)16)25-27(18,19)20/h2-7H,1H2,(H,18,19,20)(H,21,22,23) |
| InChIKey | ZLZMSPHSOVLVNS-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 153.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 431.38 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze [7-ethenyl-2-(2-fluoro-4-sulfooxyphenyl)-1,3-benzoxazol-5-yl] hydrogen sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [7-ethenyl-2-(2-fluoro-4-sulfooxyphenyl)-1,3-benzoxazol-5-yl] hydrogen sulfate?
The IUPAC name of [7-ethenyl-2-(2-fluoro-4-sulfooxyphenyl)-1,3-benzoxazol-5-yl] hydrogen sulfate (CID 11575603) is [7-ethenyl-2-(2-fluoro-4-sulfooxyphenyl)-1,3-benzoxazol-5-yl] hydrogen sulfate.
What is the SMILES notation for [7-ethenyl-2-(2-fluoro-4-sulfooxyphenyl)-1,3-benzoxazol-5-yl] hydrogen sulfate?
The canonical SMILES for [7-ethenyl-2-(2-fluoro-4-sulfooxyphenyl)-1,3-benzoxazol-5-yl] hydrogen sulfate is C=Cc1cc(OS(=O)(=O)O)cc2nc(-c3ccc(OS(=O)(=O)O)cc3F)oc12.
What is the InChIKey of [7-ethenyl-2-(2-fluoro-4-sulfooxyphenyl)-1,3-benzoxazol-5-yl] hydrogen sulfate?
The InChIKey is ZLZMSPHSOVLVNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10FNO9S2/c1-2-8-5-10(26-28(21,22)23)7-13-14(8)24-15(17-13)11-4-3-9(6-12(11)16)25-27(18,19)20/h2-7H,1H2,(H,18,19,20)(H,21,22,23).
What are the key properties of [7-ethenyl-2-(2-fluoro-4-sulfooxyphenyl)-1,3-benzoxazol-5-yl] hydrogen sulfate?
[7-ethenyl-2-(2-fluoro-4-sulfooxyphenyl)-1,3-benzoxazol-5-yl] hydrogen sulfate has a molecular weight of 431.38 g/mol, XLogP of 2.64, 6 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [7-ethenyl-2-(2-fluoro-4-sulfooxyphenyl)-1,3-benzoxazol-5-yl] hydrogen sulfate is sourced from PubChem (CID 11575603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).