C24H17ClFN3O2 — CID 11575661
4-chloro-3-(3-fluoro-4-pyridin-2-ylphenyl)-N-(6-methoxy-3-pyridinyl)benzamide (PubChem CID 11575661) has the molecular formula C24H17ClFN3O2 and a molecular weight of 433.87 g/mol. Its IUPAC name is 4-chloro-3-(3-fluoro-4-pyridin-2-ylphenyl)-N-(6-methoxy-3-pyridinyl)benzamide.
| Compound Name | 4-chloro-3-(3-fluoro-4-pyridin-2-ylphenyl)-N-(6-methoxy-3-pyridinyl)benzamide |
|---|---|
| PubChem CID | 11575661 |
| Molecular Formula | C24H17ClFN3O2 |
| Molecular Weight | 433.87 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | 4-chloro-3-(3-fluoro-4-pyridin-2-ylphenyl)-N-(6-methoxy-3-pyridinyl)benzamide |
| SMILES | COc1ccc(NC(=O)c2ccc(Cl)c(-c3ccc(-c4ccccn4)c(F)c3)c2)cn1 |
| InChI | InChI=1S/C24H17ClFN3O2/c1-31-23-10-7-17(14-28-23)29-24(30)16-6-9-20(25)19(12-16)15-5-8-18(21(26)13-15)22-4-2-3-11-27-22/h2-14H,1H3,(H,29,30) |
| InChIKey | CYVGWTPJUKCRTK-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.87 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |