C28H52O3 — CID 11575736
2,2,8,8-tetrapentyl-1,9-dioxaspiro[4.5]decan-10-one (PubChem CID 11575736) has the molecular formula C28H52O3 and a molecular weight of 436.72 g/mol. Its IUPAC name is 2,2,8,8-tetrapentyl-1,9-dioxaspiro[4.5]decan-10-one.
| Compound Name | 2,2,8,8-tetrapentyl-1,9-dioxaspiro[4.5]decan-10-one |
|---|---|
| PubChem CID | 11575736 |
| Molecular Formula | C28H52O3 |
| Molecular Weight | 436.72 g/mol |
| Exact Mass | 436.39 |
| IUPAC Name | 2,2,8,8-tetrapentyl-1,9-dioxaspiro[4.5]decan-10-one |
| SMILES | CCCCCC1(CCCCC)CCC2(CCC(CCCCC)(CCCCC)O2)C(=O)O1 |
| InChI | InChI=1S/C28H52O3/c1-5-9-13-17-26(18-14-10-6-2)21-23-28(25(29)30-26)24-22-27(31-28,19-15-11-7-3)20-16-12-8-4/h5-24H2,1-4H3 |
| InChIKey | DHCCABMTDOYYCR-UHFFFAOYSA-N |
| XLogP | 8.67 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.72 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|