C24H28FN5O2 — CID 11575755
4-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]-5-methyl-6-(3-piperidin-1-ylpropoxy)pyrrolo[2,1-f][1,2,4]triazine (PubChem CID 11575755) has the molecular formula C24H28FN5O2 and a molecular weight of 437.52 g/mol. Its IUPAC name is 4-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]-5-methyl-6-(3-piperidin-1-ylpropoxy)pyrrolo[2,1-f][1,2,4]triazine.
| Compound Name | 4-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]-5-methyl-6-(3-piperidin-1-ylpropoxy)pyrrolo[2,1-f][1,2,4]triazine |
|---|---|
| PubChem CID | 11575755 |
| Molecular Formula | C24H28FN5O2 |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | 4-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]-5-methyl-6-(3-piperidin-1-ylpropoxy)pyrrolo[2,1-f][1,2,4]triazine |
| SMILES | Cc1cc2c(F)c(Oc3ncnn4cc(OCCCN5CCCCC5)c(C)c34)ccc2[nH]1 |
| InChI | InChI=1S/C24H28FN5O2/c1-16-13-18-19(28-16)7-8-20(22(18)25)32-24-23-17(2)21(14-30(23)27-15-26-24)31-12-6-11-29-9-4-3-5-10-29/h7-8,13-15,28H,3-6,9-12H2,1-2H3 |
| InChIKey | JOPYKTLQPXTHOU-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 67.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|