C17H21NOS — CID 115757939
4-methyl-N-[(4-phenylthiophen-2-yl)methyl]oxan-4-amine (PubChem CID 115757939) has the molecular formula C17H21NOS and a molecular weight of 287.43 g/mol. Its IUPAC name is 4-methyl-N-[(4-phenylthiophen-2-yl)methyl]oxan-4-amine.
| Compound Name | 4-methyl-N-[(4-phenylthiophen-2-yl)methyl]oxan-4-amine |
|---|---|
| PubChem CID | 115757939 |
| Molecular Formula | C17H21NOS |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 4-methyl-N-[(4-phenylthiophen-2-yl)methyl]oxan-4-amine |
| SMILES | CC1(NCc2cc(-c3ccccc3)cs2)CCOCC1 |
| InChI | InChI=1S/C17H21NOS/c1-17(7-9-19-10-8-17)18-12-16-11-15(13-20-16)14-5-3-2-4-6-14/h2-6,11,13,18H,7-10,12H2,1H3 |
| InChIKey | QQPFKKYVNAUJHB-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |