About 1-cyclopentyl-3-(5,5,5-trifluoropentyl)urea
1-cyclopentyl-3-(5,5,5-trifluoropentyl)urea (PubChem CID 115758221) has the molecular formula C11H19F3N2O
and a molecular weight of 252.28 g/mol. Its IUPAC name is 1-cyclopentyl-3-(5,5,5-trifluoropentyl)urea.
Molecular Properties
| Compound Name | 1-cyclopentyl-3-(5,5,5-trifluoropentyl)urea |
| PubChem CID | 115758221 |
| Molecular Formula | C11H19F3N2O |
| Molecular Weight | 252.28 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 1-cyclopentyl-3-(5,5,5-trifluoropentyl)urea |
| SMILES | O=C(NCCCCC(F)(F)F)NC1CCCC1 |
| InChI | InChI=1S/C11H19F3N2O/c12-11(13,14)7-3-4-8-15-10(17)16-9-5-1-2-6-9/h9H,1-8H2,(H2,15,16,17) |
| InChIKey | QWXLKZFOERGUKR-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.28 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclopentyl-3-(5,5,5-trifluoropentyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopentyl-3-(5,5,5-trifluoropentyl)urea?
The IUPAC name of 1-cyclopentyl-3-(5,5,5-trifluoropentyl)urea (CID 115758221) is 1-cyclopentyl-3-(5,5,5-trifluoropentyl)urea.
What is the SMILES notation for 1-cyclopentyl-3-(5,5,5-trifluoropentyl)urea?
The canonical SMILES for 1-cyclopentyl-3-(5,5,5-trifluoropentyl)urea is O=C(NCCCCC(F)(F)F)NC1CCCC1.
What is the InChIKey of 1-cyclopentyl-3-(5,5,5-trifluoropentyl)urea?
The InChIKey is QWXLKZFOERGUKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19F3N2O/c12-11(13,14)7-3-4-8-15-10(17)16-9-5-1-2-6-9/h9H,1-8H2,(H2,15,16,17).
What are the key properties of 1-cyclopentyl-3-(5,5,5-trifluoropentyl)urea?
1-cyclopentyl-3-(5,5,5-trifluoropentyl)urea has a molecular weight of 252.28 g/mol, XLogP of 2.96, 5 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopentyl-3-(5,5,5-trifluoropentyl)urea is sourced from PubChem (CID 115758221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).