C22H16F2N2O6 — CID 11575840
(Z)-4-[1,3-bis[(2-fluorophenyl)methyl]-2,4-dioxopyrimidin-5-yl]-4-hydroxy-2-oxobut-3-enoic acid (PubChem CID 11575840) has the molecular formula C22H16F2N2O6 and a molecular weight of 442.37 g/mol. Its IUPAC name is (Z)-4-[1,3-bis[(2-fluorophenyl)methyl]-2,4-dioxopyrimidin-5-yl]-4-hydroxy-2-oxobut-3-enoic acid.
| Compound Name | (Z)-4-[1,3-bis[(2-fluorophenyl)methyl]-2,4-dioxopyrimidin-5-yl]-4-hydroxy-2-oxobut-3-enoic acid |
|---|---|
| PubChem CID | 11575840 |
| Molecular Formula | C22H16F2N2O6 |
| Molecular Weight | 442.37 g/mol |
| Exact Mass | 442.10 |
| IUPAC Name | (Z)-4-[1,3-bis[(2-fluorophenyl)methyl]-2,4-dioxopyrimidin-5-yl]-4-hydroxy-2-oxobut-3-enoic acid |
| SMILES | O=C(O)C(=O)/C=C(\O)c1cn(Cc2ccccc2F)c(=O)n(Cc2ccccc2F)c1=O |
| InChI | InChI=1S/C22H16F2N2O6/c23-16-7-3-1-5-13(16)10-25-12-15(18(27)9-19(28)21(30)31)20(29)26(22(25)32)11-14-6-2-4-8-17(14)24/h1-9,12,27H,10-11H2,(H,30,31)/b18-9- |
| InChIKey | YDLORTWEOBCEIX-NVMNQCDNSA-N |
| XLogP | 1.94 |
| TPSA | 118.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.37 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|