C23H19BrN2O3 — CID 11576025
2-(3-bromophenyl)-6-(oxolan-2-ylmethylamino)benzo[de]isoquinoline-1,3-dione (PubChem CID 11576025) has the molecular formula C23H19BrN2O3 and a molecular weight of 451.32 g/mol. Its IUPAC name is 2-(3-bromophenyl)-6-(oxolan-2-ylmethylamino)benzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-(3-bromophenyl)-6-(oxolan-2-ylmethylamino)benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 11576025 |
| Molecular Formula | C23H19BrN2O3 |
| Molecular Weight | 451.32 g/mol |
| Exact Mass | 450.06 |
| IUPAC Name | 2-(3-bromophenyl)-6-(oxolan-2-ylmethylamino)benzo[de]isoquinoline-1,3-dione |
| SMILES | O=C1c2cccc3c(NCC4CCCO4)ccc(c23)C(=O)N1c1cccc(Br)c1 |
| InChI | InChI=1S/C23H19BrN2O3/c24-14-4-1-5-15(12-14)26-22(27)18-8-2-7-17-20(25-13-16-6-3-11-29-16)10-9-19(21(17)18)23(26)28/h1-2,4-5,7-10,12,16,25H,3,6,11,13H2 |
| InChIKey | JHVDJFAMMYJNHA-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.32 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|