C11H15N3O2 — CID 115760472
5-(4-aminopiperidin-1-yl)pyridine-2-carboxylic acid (PubChem CID 115760472) has the molecular formula C11H15N3O2 and a molecular weight of 221.26 g/mol. Its IUPAC name is 5-(4-aminopiperidin-1-yl)pyridine-2-carboxylic acid.
| Compound Name | 5-(4-aminopiperidin-1-yl)pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 115760472 |
| Molecular Formula | C11H15N3O2 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 5-(4-aminopiperidin-1-yl)pyridine-2-carboxylic acid |
| SMILES | NC1CCN(c2ccc(C(=O)O)nc2)CC1 |
| InChI | InChI=1S/C11H15N3O2/c12-8-3-5-14(6-4-8)9-1-2-10(11(15)16)13-7-9/h1-2,7-8H,3-6,12H2,(H,15,16) |
| InChIKey | ASQMHQLTDOEZIH-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 79.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |