C10H12N2OS — CID 115763203
5-[[[1-(hydroxymethyl)cyclopropyl]amino]methyl]thiophene-3-carbonitrile (PubChem CID 115763203) has the molecular formula C10H12N2OS and a molecular weight of 208.29 g/mol. Its IUPAC name is 5-[[[1-(hydroxymethyl)cyclopropyl]amino]methyl]thiophene-3-carbonitrile.
| Compound Name | 5-[[[1-(hydroxymethyl)cyclopropyl]amino]methyl]thiophene-3-carbonitrile |
|---|---|
| PubChem CID | 115763203 |
| Molecular Formula | C10H12N2OS |
| Molecular Weight | 208.29 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | 5-[[[1-(hydroxymethyl)cyclopropyl]amino]methyl]thiophene-3-carbonitrile |
| SMILES | N#Cc1csc(CNC2(CO)CC2)c1 |
| InChI | InChI=1S/C10H12N2OS/c11-4-8-3-9(14-6-8)5-12-10(7-13)1-2-10/h3,6,12-13H,1-2,5,7H2 |
| InChIKey | KSPNBYBIDORICV-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 56.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.29 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |