About 4-[4-[[2,5-bis(trifluoromethyl)phenyl]methoxy]benzoyl]benzoic acid
4-[4-[[2,5-bis(trifluoromethyl)phenyl]methoxy]benzoyl]benzoic acid (PubChem CID 11576377) has the molecular formula C23H14F6O4
and a molecular weight of 468.35 g/mol. Its IUPAC name is 4-[4-[[2,5-bis(trifluoromethyl)phenyl]methoxy]benzoyl]benzoic acid.
Molecular Properties
| Compound Name | 4-[4-[[2,5-bis(trifluoromethyl)phenyl]methoxy]benzoyl]benzoic acid |
| PubChem CID | 11576377 |
| Molecular Formula | C23H14F6O4 |
| Molecular Weight | 468.35 g/mol |
| Exact Mass | 468.08 |
| IUPAC Name | 4-[4-[[2,5-bis(trifluoromethyl)phenyl]methoxy]benzoyl]benzoic acid |
| SMILES | O=C(O)c1ccc(C(=O)c2ccc(OCc3cc(C(F)(F)F)ccc3C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C23H14F6O4/c24-22(25,26)17-7-10-19(23(27,28)29)16(11-17)12-33-18-8-5-14(6-9-18)20(30)13-1-3-15(4-2-13)21(31)32/h1-11H,12H2,(H,31,32) |
| InChIKey | JISJZWXKAKZZER-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 468.35 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[4-[[2,5-bis(trifluoromethyl)phenyl]methoxy]benzoyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-[[2,5-bis(trifluoromethyl)phenyl]methoxy]benzoyl]benzoic acid?
The IUPAC name of 4-[4-[[2,5-bis(trifluoromethyl)phenyl]methoxy]benzoyl]benzoic acid (CID 11576377) is 4-[4-[[2,5-bis(trifluoromethyl)phenyl]methoxy]benzoyl]benzoic acid.
What is the SMILES notation for 4-[4-[[2,5-bis(trifluoromethyl)phenyl]methoxy]benzoyl]benzoic acid?
The canonical SMILES for 4-[4-[[2,5-bis(trifluoromethyl)phenyl]methoxy]benzoyl]benzoic acid is O=C(O)c1ccc(C(=O)c2ccc(OCc3cc(C(F)(F)F)ccc3C(F)(F)F)cc2)cc1.
What is the InChIKey of 4-[4-[[2,5-bis(trifluoromethyl)phenyl]methoxy]benzoyl]benzoic acid?
The InChIKey is JISJZWXKAKZZER-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H14F6O4/c24-22(25,26)17-7-10-19(23(27,28)29)16(11-17)12-33-18-8-5-14(6-9-18)20(30)13-1-3-15(4-2-13)21(31)32/h1-11H,12H2,(H,31,32).
What are the key properties of 4-[4-[[2,5-bis(trifluoromethyl)phenyl]methoxy]benzoyl]benzoic acid?
4-[4-[[2,5-bis(trifluoromethyl)phenyl]methoxy]benzoyl]benzoic acid has a molecular weight of 468.35 g/mol, XLogP of 6.23, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-[[2,5-bis(trifluoromethyl)phenyl]methoxy]benzoyl]benzoic acid is sourced from PubChem (CID 11576377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).