C12H21NO — CID 115763772
N-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]cyclopentanamine (PubChem CID 115763772) has the molecular formula C12H21NO and a molecular weight of 195.31 g/mol. Its IUPAC name is N-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]cyclopentanamine.
| Compound Name | N-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]cyclopentanamine |
|---|---|
| PubChem CID | 115763772 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | N-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]cyclopentanamine |
| SMILES | C1=C(CCNC2CCCC2)CCOC1 |
| InChI | InChI=1S/C12H21NO/c1-2-4-12(3-1)13-8-5-11-6-9-14-10-7-11/h6,12-13H,1-5,7-10H2 |
| InChIKey | SKYKCDCFZNEOTM-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|