C23H28N6OS2 — CID 11576387
5-[5-[3-(2-ethyl-5,6,8,9-tetrahydro-[1,3]thiazolo[4,5-h][3]benzazepin-7-yl)propylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]-4-methyl-1,3-oxazole (PubChem CID 11576387) has the molecular formula C23H28N6OS2 and a molecular weight of 468.65 g/mol. Its IUPAC name is 5-[5-[3-(2-ethyl-5,6,8,9-tetrahydro-[1,3]thiazolo[4,5-h][3]benzazepin-7-yl)propylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]-4-methyl-1,3-oxazole.
| Compound Name | 5-[5-[3-(2-ethyl-5,6,8,9-tetrahydro-[1,3]thiazolo[4,5-h][3]benzazepin-7-yl)propylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]-4-methyl-1,3-oxazole |
|---|---|
| PubChem CID | 11576387 |
| Molecular Formula | C23H28N6OS2 |
| Molecular Weight | 468.65 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | 5-[5-[3-(2-ethyl-5,6,8,9-tetrahydro-[1,3]thiazolo[4,5-h][3]benzazepin-7-yl)propylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]-4-methyl-1,3-oxazole |
| SMILES | CCc1nc2cc3c(cc2s1)CCN(CCCSc1nnc(-c2ocnc2C)n1C)CC3 |
| InChI | InChI=1S/C23H28N6OS2/c1-4-20-25-18-12-16-6-9-29(10-7-17(16)13-19(18)32-20)8-5-11-31-23-27-26-22(28(23)3)21-15(2)24-14-30-21/h12-14H,4-11H2,1-3H3 |
| InChIKey | JNTWHFOMVSHHKK-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 72.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.65 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|