C12H16BrNO3S — CID 115764428
2-bromo-5-methoxy-N-(2-methylsulfinylpropyl)benzamide (PubChem CID 115764428) has the molecular formula C12H16BrNO3S and a molecular weight of 334.24 g/mol. Its IUPAC name is 2-bromo-5-methoxy-N-(2-methylsulfinylpropyl)benzamide.
| Compound Name | 2-bromo-5-methoxy-N-(2-methylsulfinylpropyl)benzamide |
|---|---|
| PubChem CID | 115764428 |
| Molecular Formula | C12H16BrNO3S |
| Molecular Weight | 334.24 g/mol |
| Exact Mass | 333.00 |
| IUPAC Name | 2-bromo-5-methoxy-N-(2-methylsulfinylpropyl)benzamide |
| SMILES | COc1ccc(Br)c(C(=O)NCC(C)S(C)=O)c1 |
| InChI | InChI=1S/C12H16BrNO3S/c1-8(18(3)16)7-14-12(15)10-6-9(17-2)4-5-11(10)13/h4-6,8H,7H2,1-3H3,(H,14,15) |
| InChIKey | UBOYZCWSWCAKLT-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.24 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |